C23H34F4O4 — CID 58372407
1-O-(1-cyclopentylcyclohexyl) 4-O-(1-ethylcyclohexyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 58372407) has the molecular formula C23H34F4O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is 1-O-(1-cyclopentylcyclohexyl) 4-O-(1-ethylcyclohexyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | 1-O-(1-cyclopentylcyclohexyl) 4-O-(1-ethylcyclohexyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 58372407 |
| Molecular Formula | C23H34F4O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-O-(1-cyclopentylcyclohexyl) 4-O-(1-ethylcyclohexyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | CCC1(OC(=O)C(F)(F)C(F)(F)C(=O)OC2(C3CCCC3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C23H34F4O4/c1-2-20(13-7-3-8-14-20)30-18(28)22(24,25)23(26,27)19(29)31-21(15-9-4-10-16-21)17-11-5-6-12-17/h17H,2-16H2,1H3 |
| InChIKey | WLAAVXKNNNXADD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|