C20H26F4O4 — CID 58372446
1-O-(1-ethylcyclopropyl) 4-O-(2-methyl-2-adamantyl) 2,2,3,3-tetrafluorobutanedioate (PubChem CID 58372446) has the molecular formula C20H26F4O4 and a molecular weight of 406.42 g/mol. Its IUPAC name is 1-O-(1-ethylcyclopropyl) 4-O-(2-methyl-2-adamantyl) 2,2,3,3-tetrafluorobutanedioate.
| Compound Name | 1-O-(1-ethylcyclopropyl) 4-O-(2-methyl-2-adamantyl) 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 58372446 |
| Molecular Formula | C20H26F4O4 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-O-(1-ethylcyclopropyl) 4-O-(2-methyl-2-adamantyl) 2,2,3,3-tetrafluorobutanedioate |
| SMILES | CCC1(OC(=O)C(F)(F)C(F)(F)C(=O)OC2(C)C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C20H26F4O4/c1-3-18(4-5-18)28-16(26)20(23,24)19(21,22)15(25)27-17(2)13-7-11-6-12(9-13)10-14(17)8-11/h11-14H,3-10H2,1-2H3 |
| InChIKey | UKHPWWRIVPZALN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|