About ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate
ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 143714438) has the molecular formula C17H25F3O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 143714438 |
| Molecular Formula | C17H25F3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(F)(F)F.CC |
| InChI | InChI=1S/C15H19F3O2.C2H6/c1-8(15(16,17)18)13(19)20-14(2)11-4-9-3-10(6-11)7-12(14)5-9;1-2/h9-12H,1,3-7H2,2H3;1-2H3 |
| InChIKey | UKGIGHLBGNTDAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate (CID 143714438) is ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC1(C)C2CC3CC(C2)CC1C3)C(F)(F)F.CC.
What is the InChIKey of ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is UKGIGHLBGNTDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3O2.C2H6/c1-8(15(16,17)18)13(19)20-14(2)11-4-9-3-10(6-11)7-12(14)5-9;1-2/h9-12H,1,3-7H2,2H3;1-2H3.
What are the key properties of ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate?
ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 318.38 g/mol, XLogP of 4.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2-methyl-2-adamantyl) 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 143714438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).