C23H38F6O3Si — CID 91153537
4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;methoxy(trimethyl)silane (PubChem CID 91153537) has the molecular formula C23H38F6O3Si and a molecular weight of 504.63 g/mol. Its IUPAC name is 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;methoxy(trimethyl)silane.
| Compound Name | 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;methoxy(trimethyl)silane |
|---|---|
| PubChem CID | 91153537 |
| Molecular Formula | C23H38F6O3Si |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]tetracyclo[6.2.1.13,6.02,7]dodecane;methoxy(trimethyl)silane |
| SMILES | CCOCOC(CC1CC2CC1C1C3CCC(C3)C21)(C(F)(F)F)C(F)(F)F.CO[Si](C)(C)C |
| InChI | InChI=1S/C19H26F6O2.C4H12OSi/c1-2-26-9-27-17(18(20,21)22,19(23,24)25)8-13-6-12-7-14(13)16-11-4-3-10(5-11)15(12)16;1-5-6(2,3)4/h10-16H,2-9H2,1H3;1-4H3 |
| InChIKey | MPNZJVBTUQLZGB-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|