C21H38O3Si — CID 90822079
tert-butyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methoxy(trimethyl)silane (PubChem CID 90822079) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is tert-butyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methoxy(trimethyl)silane.
| Compound Name | tert-butyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methoxy(trimethyl)silane |
|---|---|
| PubChem CID | 90822079 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | tert-butyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methoxy(trimethyl)silane |
| SMILES | CC(C)(C)OC(=O)C1CC2CC1C1C3CCC(C3)C21.CO[Si](C)(C)C |
| InChI | InChI=1S/C17H26O2.C4H12OSi/c1-17(2,3)19-16(18)13-8-11-7-12(13)15-10-5-4-9(6-10)14(11)15;1-5-6(2,3)4/h9-15H,4-8H2,1-3H3;1-4H3 |
| InChIKey | JQIFGLRWPHKPQA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|