C20H28O4 — CID 10246191
tert-butyl 9-prop-2-enoyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 10246191) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 9-prop-2-enoyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | tert-butyl 9-prop-2-enoyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 10246191 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | tert-butyl 9-prop-2-enoyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | C=CC(=O)OC1CC2CC1C1C3CC(C(=O)OC(C)(C)C)C(C3)C21 |
| InChI | InChI=1S/C20H28O4/c1-5-16(21)23-15-9-11-8-14(15)18-10-6-12(17(11)18)13(7-10)19(22)24-20(2,3)4/h5,10-15,17-18H,1,6-9H2,2-4H3 |
| InChIKey | DFJJHAXJJHQELC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|