C24H42O5S2 — CID 143325662
2-methylpropane;2-methylsulfanylbutan-2-yl 10-acetyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;sulfanol (PubChem CID 143325662) has the molecular formula C24H42O5S2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-methylpropane;2-methylsulfanylbutan-2-yl 10-acetyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;sulfanol.
| Compound Name | 2-methylpropane;2-methylsulfanylbutan-2-yl 10-acetyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;sulfanol |
|---|---|
| PubChem CID | 143325662 |
| Molecular Formula | C24H42O5S2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-methylpropane;2-methylsulfanylbutan-2-yl 10-acetyloxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;sulfanol |
| SMILES | CC(C)C.CCC(C)(OC(=O)C1CC2CC1C1C3CC(CC3OC(C)=O)C21)SC.OS |
| InChI | InChI=1S/C20H30O4S.C4H10.H2OS/c1-5-20(3,25-4)24-19(22)14-7-11-6-13(14)18-15-8-12(17(11)18)9-16(15)23-10(2)21;1-4(2)3;1-2/h11-18H,5-9H2,1-4H3;4H,1-3H3;1-2H |
| InChIKey | NGNNKNUPQWICKM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|