C30H50O4 — CID 163476957
(1-ethylcyclopentyl) 10-(1-hydroxy-4,4-dimethyl-2-propan-2-ylpentoxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 163476957) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 10-(1-hydroxy-4,4-dimethyl-2-propan-2-ylpentoxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (1-ethylcyclopentyl) 10-(1-hydroxy-4,4-dimethyl-2-propan-2-ylpentoxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 163476957 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (1-ethylcyclopentyl) 10-(1-hydroxy-4,4-dimethyl-2-propan-2-ylpentoxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCC1(OC(=O)C2CC3CC2C2C4CC(CC4OC(O)C(CC(C)(C)C)C(C)C)C32)CCCC1 |
| InChI | InChI=1S/C30H50O4/c1-7-30(10-8-9-11-30)34-28(32)21-13-18-12-20(21)26-22-14-19(25(18)26)15-24(22)33-27(31)23(17(2)3)16-29(4,5)6/h17-27,31H,7-16H2,1-6H3 |
| InChIKey | CBGLGNZIIMCQQD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|