C16H25I2O2- — CID 147785257
(1-ethylcyclopentyl) 6-iodo-5-methyliodanuidylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 147785257) has the molecular formula C16H25I2O2- and a molecular weight of 503.18 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 6-iodo-5-methyliodanuidylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1-ethylcyclopentyl) 6-iodo-5-methyliodanuidylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 147785257 |
| Molecular Formula | C16H25I2O2- |
| Molecular Weight | 503.18 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | (1-ethylcyclopentyl) 6-iodo-5-methyliodanuidylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCC1(OC(=O)C2CC3CC2C(I)C3[I-]C)CCCC1 |
| InChI | InChI=1S/C16H25I2O2/c1-3-16(6-4-5-7-16)20-15(19)12-9-10-8-11(12)13(17)14(10)18-2/h10-14H,3-9H2,1-2H3/q-1 |
| InChIKey | UMXMBGPYLXILCI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|