C32H50O6 — CID 160989366
methane;(4-oxo-2-adamantyl)oxymethyl 10-(2,2-dimethylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 160989366) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is methane;(4-oxo-2-adamantyl)oxymethyl 10-(2,2-dimethylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | methane;(4-oxo-2-adamantyl)oxymethyl 10-(2,2-dimethylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 160989366 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | methane;(4-oxo-2-adamantyl)oxymethyl 10-(2,2-dimethylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | C.C.CCC(C)(C)C(=O)OC1CC2CC1C1C3CC(CC3C(=O)OCOC3C4CC5CC(C4)C(=O)C3C5)C21 |
| InChI | InChI=1S/C30H42O6.2CH4/c1-4-30(2,3)29(33)36-23-12-16-11-21(23)25-19-9-15(24(16)25)10-20(19)28(32)35-13-34-27-18-6-14-5-17(8-18)26(31)22(27)7-14;;/h14-25,27H,4-13H2,1-3H3;2*1H4 |
| InChIKey | TUKLIBRBPHTXJE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|