C30H42O5 — CID 59435140
(4-oxo-2-adamantyl)oxymethyl 10-(3-methyl-2-oxopentyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 59435140) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is (4-oxo-2-adamantyl)oxymethyl 10-(3-methyl-2-oxopentyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | (4-oxo-2-adamantyl)oxymethyl 10-(3-methyl-2-oxopentyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 59435140 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (4-oxo-2-adamantyl)oxymethyl 10-(3-methyl-2-oxopentyl)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCC(C)C(=O)CC1CC2CC1C1C3CC(CC3C(=O)OCOC3C4CC5CC(C4)C(=O)C3C5)C21 |
| InChI | InChI=1S/C30H42O5/c1-3-14(2)25(31)12-16-7-17-9-21(16)27-22-10-18(26(17)27)11-23(22)30(33)35-13-34-29-20-5-15-4-19(8-20)28(32)24(29)6-15/h14-24,26-27,29H,3-13H2,1-2H3 |
| InChIKey | AEGPFSCEIBURBB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|