C26H44O4 — CID 161322337
butane;2,2-dimethylpropyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl prop-2-enoate (PubChem CID 161322337) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is butane;2,2-dimethylpropyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl prop-2-enoate.
| Compound Name | butane;2,2-dimethylpropyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 161322337 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | butane;2,2-dimethylpropyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.CC(C)(C)COC(=O)C1CC2CC1C1C3CCC(C3)C21.CCCC |
| InChI | InChI=1S/C18H28O2.C4H6O2.C4H10/c1-18(2,3)9-20-17(19)14-8-12-7-13(14)16-11-5-4-10(6-11)15(12)16;1-3-4(5)6-2;1-3-4-2/h10-16H,4-9H2,1-3H3;3H,1H2,2H3;3-4H2,1-2H3 |
| InChIKey | VKHRELCAJVVPPD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|