C16H24O5S — CID 59360493
3-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid (PubChem CID 59360493) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is 3-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid.
| Compound Name | 3-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59360493 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
| SMILES | O=C(OCCCS(=O)(=O)O)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C16H24O5S/c17-16(21-4-1-5-22(18,19)20)13-8-11-7-12(13)15-10-3-2-9(6-10)14(11)15/h9-15H,1-8H2,(H,18,19,20) |
| InChIKey | BBJWTIXXKLCXCL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|