C17H23F3O5S — CID 90396266
3,3,3-trifluoro-2-methyl-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid (PubChem CID 90396266) has the molecular formula C17H23F3O5S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90396266 |
| Molecular Formula | C17H23F3O5S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(tetracyclo[6.2.1.13,6.02,7]dodecane-4-carbonyloxy)propane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)(OC(=O)C1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C17H23F3O5S/c1-16(17(18,19)20,7-26(22,23)24)25-15(21)12-6-10-5-11(12)14-9-3-2-8(4-9)13(10)14/h8-14H,2-7H2,1H3,(H,22,23,24) |
| InChIKey | YWAAMVKSMJBMQT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|