C32H50O5 — CID 90978913
1-(2-adamantyloxy)ethyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl 2,2-dimethylbutanoate (PubChem CID 90978913) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 1-(2-adamantyloxy)ethyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl 2,2-dimethylbutanoate.
| Compound Name | 1-(2-adamantyloxy)ethyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90978913 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 1-(2-adamantyloxy)ethyl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate;methyl 2,2-dimethylbutanoate |
| SMILES | CC(OC(=O)C1CC2CC1C1C3CCC(C3)C21)OC1C2CC3CC(C2)CC1C3.CCC(C)(C)C(=O)OC |
| InChI | InChI=1S/C25H36O3.C7H14O2/c1-12(27-24-18-5-13-4-14(7-18)8-19(24)6-13)28-25(26)21-11-17-10-20(21)23-16-3-2-15(9-16)22(17)23;1-5-7(2,3)6(8)9-4/h12-24H,2-11H2,1H3;5H2,1-4H3 |
| InChIKey | JWDDZDOHXJXVHI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|