C17H21F5O2 — CID 71263581
1,1,1,3,3-pentafluorobutan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 71263581) has the molecular formula C17H21F5O2 and a molecular weight of 352.34 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluorobutan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1,1,1,3,3-pentafluorobutan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 71263581 |
| Molecular Formula | C17H21F5O2 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 1,1,1,3,3-pentafluorobutan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(F)(F)C(OC(=O)C1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C17H21F5O2/c1-16(18,19)15(17(20,21)22)24-14(23)11-6-9-5-10(11)13-8-3-2-7(4-8)12(9)13/h7-13,15H,2-6H2,1H3 |
| InChIKey | PTQYDGAQKOQLBA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|