C14H17F2OSg- — CID 146898002
2,2-difluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanone;seaborgium (PubChem CID 146898002) has the molecular formula C14H17F2OSg- and a molecular weight of 508.29 g/mol. Its IUPAC name is 2,2-difluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanone;seaborgium.
| Compound Name | 2,2-difluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanone;seaborgium |
|---|---|
| PubChem CID | 146898002 |
| Molecular Formula | C14H17F2OSg- |
| Molecular Weight | 508.29 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 2,2-difluoro-1-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanone;seaborgium |
| SMILES | O=C([C-](F)F)C1CC2CC1C1C3CCC(C3)C21.[Sg] |
| InChI | InChI=1S/C14H17F2O.Sg/c15-14(16)13(17)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12;/h6-12H,1-5H2;/q-1; |
| InChIKey | LNECNGOQIJMDOX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|