C15H21F5O6S — CID 58021732
[1,1,1,3,3-pentafluoro-3-(trioxidanylsulfanyl)propan-2-yl] 5-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58021732) has the molecular formula C15H21F5O6S and a molecular weight of 424.38 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-(trioxidanylsulfanyl)propan-2-yl] 5-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-(trioxidanylsulfanyl)propan-2-yl] 5-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58021732 |
| Molecular Formula | C15H21F5O6S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-(trioxidanylsulfanyl)propan-2-yl] 5-[(2-methylpropan-2-yl)oxy]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC1CC2CC1CC2C(=O)OC(C(F)(F)F)C(F)(F)SOOO |
| InChI | InChI=1S/C15H21F5O6S/c1-13(2,3)24-10-6-7-4-8(10)5-9(7)11(21)23-12(14(16,17)18)15(19,20)27-26-25-22/h7-10,12,22H,4-6H2,1-3H3 |
| InChIKey | VGKSOGVGWGTPEA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|