C14H22F4O — CID 89137075
2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane (PubChem CID 89137075) has the molecular formula C14H22F4O and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 89137075 |
| Molecular Formula | C14H22F4O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)OC1CC2CC1CC2C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C14H22F4O/c1-12(2,3)19-11-7-8-5-9(11)6-10(8)14(17,18)13(4,15)16/h8-11H,5-7H2,1-4H3 |
| InChIKey | QZBQLOQSVRAMHX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|