C10H11BrF4O2 — CID 139995609
[5-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] formate (PubChem CID 139995609) has the molecular formula C10H11BrF4O2 and a molecular weight of 319.09 g/mol. Its IUPAC name is [5-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] formate.
| Compound Name | [5-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] formate |
|---|---|
| PubChem CID | 139995609 |
| Molecular Formula | C10H11BrF4O2 |
| Molecular Weight | 319.09 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | [5-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-bicyclo[2.2.1]heptanyl] formate |
| SMILES | O=COC1CC2CC1CC2C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C10H11BrF4O2/c11-10(14,15)9(12,13)7-2-6-1-5(7)3-8(6)17-4-16/h4-8H,1-3H2 |
| InChIKey | WHHVOCIHARUOEE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.09 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|