C14H20F4O4S — CID 89369481
1,1,2,2-tetrafluoro-2-[5-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]ethanesulfinic acid (PubChem CID 89369481) has the molecular formula C14H20F4O4S and a molecular weight of 360.37 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[5-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]ethanesulfinic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[5-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]ethanesulfinic acid |
|---|---|
| PubChem CID | 89369481 |
| Molecular Formula | C14H20F4O4S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[5-(oxan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]ethanesulfinic acid |
| SMILES | O=S(O)C(F)(F)C(F)(F)C1CC2CC1CC2OC1CCCCO1 |
| InChI | InChI=1S/C14H20F4O4S/c15-13(16,14(17,18)23(19)20)10-6-9-5-8(10)7-11(9)22-12-3-1-2-4-21-12/h8-12H,1-7H2,(H,19,20) |
| InChIKey | QNPZTYBIAYZYGW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|