C16H26O5S — CID 124783280
[(1S,2R,4S,7R,9S,10S)-9-[(2R)-oxan-2-yl]oxy-2-tricyclo[5.2.1.04,10]decanyl] methanesulfonate (PubChem CID 124783280) has the molecular formula C16H26O5S and a molecular weight of 330.45 g/mol. Its IUPAC name is [(1S,2R,4S,7R,9S,10S)-9-[(2R)-oxan-2-yl]oxy-2-tricyclo[5.2.1.04,10]decanyl] methanesulfonate.
| Compound Name | [(1S,2R,4S,7R,9S,10S)-9-[(2R)-oxan-2-yl]oxy-2-tricyclo[5.2.1.04,10]decanyl] methanesulfonate |
|---|---|
| PubChem CID | 124783280 |
| Molecular Formula | C16H26O5S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(1S,2R,4S,7R,9S,10S)-9-[(2R)-oxan-2-yl]oxy-2-tricyclo[5.2.1.04,10]decanyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](O[C@@H]4CCCCO4)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C16H26O5S/c1-22(17,18)21-13-9-11-6-5-10-8-12(16(13)15(10)11)20-14-4-2-3-7-19-14/h10-16H,2-9H2,1H3/t10-,11+,12+,13-,14-,15+,16+/m1/s1 |
| InChIKey | NKITVIAMISOQED-NMPAGYRCSA-N |
| XLogP | 2.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|