C12H22O7S — CID 54078925
[(2R,3S)-5-methoxy-2-(oxan-2-yloxymethyl)oxolan-3-yl] methanesulfonate (PubChem CID 54078925) has the molecular formula C12H22O7S and a molecular weight of 310.37 g/mol. Its IUPAC name is [(2R,3S)-5-methoxy-2-(oxan-2-yloxymethyl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S)-5-methoxy-2-(oxan-2-yloxymethyl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 54078925 |
| Molecular Formula | C12H22O7S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [(2R,3S)-5-methoxy-2-(oxan-2-yloxymethyl)oxolan-3-yl] methanesulfonate |
| SMILES | COC1C[C@H](OS(C)(=O)=O)[C@@H](COC2CCCCO2)O1 |
| InChI | InChI=1S/C12H22O7S/c1-15-12-7-9(19-20(2,13)14)10(18-12)8-17-11-5-3-4-6-16-11/h9-12H,3-8H2,1-2H3/t9-,10+,11?,12?/m0/s1 |
| InChIKey | MLRQBPNPQCPAOK-DMOGRIERSA-N |
| XLogP | 0.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|