C14H26O7 — CID 139800087
[(2S,3S,4R,5R,6R)-3,4,5-trimethoxy-6-(oxolan-2-yloxymethyl)oxan-2-yl]methanol (PubChem CID 139800087) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3,4,5-trimethoxy-6-(oxolan-2-yloxymethyl)oxan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5R,6R)-3,4,5-trimethoxy-6-(oxolan-2-yloxymethyl)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 139800087 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3,4,5-trimethoxy-6-(oxolan-2-yloxymethyl)oxan-2-yl]methanol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](CO)O[C@H](COC2CCCO2)[C@H]1OC |
| InChI | InChI=1S/C14H26O7/c1-16-12-9(7-15)21-10(13(17-2)14(12)18-3)8-20-11-5-4-6-19-11/h9-15H,4-8H2,1-3H3/t9-,10+,11?,12-,13+,14+/m0/s1 |
| InChIKey | JXKSSINQBASXEE-DEIZTLOISA-N |
| XLogP | -0.06 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |