C7H14O5 — CID 131205336
(2S,3R,4S,5R)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-ol (PubChem CID 131205336) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (2S,3R,4S,5R)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-ol.
| Compound Name | (2S,3R,4S,5R)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-ol |
|---|---|
| PubChem CID | 131205336 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2S,3R,4S,5R)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-ol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@@H](CO)O[C@@H]1O |
| InChI | InChI=1S/C7H14O5/c1-10-5-4(3-8)12-7(9)6(5)11-2/h4-9H,3H2,1-2H3/t4-,5+,6-,7+/m1/s1 |
| InChIKey | LVAJSMKIHHMQGU-UCROKIRRSA-N |
| XLogP | -1.27 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |