C7H15NO6 — CID 118274798
(2R,3R,4R,5R)-4-aminooxy-6-(hydroxymethyl)-3-methoxyoxane-2,5-diol (PubChem CID 118274798) has the molecular formula C7H15NO6 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-aminooxy-6-(hydroxymethyl)-3-methoxyoxane-2,5-diol.
| Compound Name | (2R,3R,4R,5R)-4-aminooxy-6-(hydroxymethyl)-3-methoxyoxane-2,5-diol |
|---|---|
| PubChem CID | 118274798 |
| Molecular Formula | C7H15NO6 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2R,3R,4R,5R)-4-aminooxy-6-(hydroxymethyl)-3-methoxyoxane-2,5-diol |
| SMILES | CO[C@@H]1[C@H](ON)[C@H](O)C(CO)O[C@H]1O |
| InChI | InChI=1S/C7H15NO6/c1-12-6-5(14-8)4(10)3(2-9)13-7(6)11/h3-7,9-11H,2,8H2,1H3/t3?,4-,5-,6-,7-/m1/s1 |
| InChIKey | IEERVFYRQRLPNT-VHQZISHXSA-N |
| XLogP | -2.67 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|