C11H26O6 — CID 170573273
ethane;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol (PubChem CID 170573273) has the molecular formula C11H26O6 and a molecular weight of 254.32 g/mol. Its IUPAC name is ethane;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol.
| Compound Name | ethane;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 170573273 |
| Molecular Formula | C11H26O6 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | ethane;(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-methoxyoxane-2,4,5-triol |
| SMILES | CC.CC.CO[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C7H14O6.2C2H6/c1-12-6-5(10)4(9)3(2-8)13-7(6)11;2*1-2/h3-11H,2H2,1H3;2*1-2H3/t3-,4-,5+,6-,7-;;/m1../s1 |
| InChIKey | TWRGFNSVBGHJEE-LWAXSXSZSA-N |
| XLogP | -0.51 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |