C7H14O6 — CID 171713800
(2S,3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxy(2,3,4,5,6-13C5)oxane-2,3,5-triol (PubChem CID 171713800) has the molecular formula C7H14O6 and a molecular weight of 200.14 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxy(2,3,4,5,6-13C5)oxane-2,3,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxy(2,3,4,5,6-13C5)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 171713800 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxy(2,3,4,5,6-13C5)oxane-2,3,5-triol |
| SMILES | CO[13C@@H]1[13C@@H](O)[13C@@H](O)O[13C@H]([13CH2]O)[13C@H]1O |
| InChI | InChI=1S/C7H14O6/c1-12-6-4(9)3(2-8)13-7(11)5(6)10/h3-11H,2H2,1H3/t3-,4-,5-,6+,7+/m1/s1/i2+1,3+1,4+1,5+1,6+1,7+1 |
| InChIKey | SCBBSJMAPKXHAH-VBXKGHMMSA-N |
| XLogP | -2.57 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |