C12H22O6 — CID 11010775
[(2R,3S,4S,5R,6S)-3,4,5-trimethoxy-6-prop-2-enoxyoxan-2-yl]methanol (PubChem CID 11010775) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trimethoxy-6-prop-2-enoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trimethoxy-6-prop-2-enoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 11010775 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trimethoxy-6-prop-2-enoxyoxan-2-yl]methanol |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C12H22O6/c1-5-6-17-12-11(16-4)10(15-3)9(14-2)8(7-13)18-12/h5,8-13H,1,6-7H2,2-4H3/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | IXHQUWYLYPCJIL-IIRVCBMXSA-N |
| XLogP | -0.05 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|