C16H28O10 — CID 101154089
(2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-prop-2-enoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 101154089) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-prop-2-enoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-prop-2-enoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 101154089 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-[(2R,3R,4S,5R,6R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-prop-2-enoxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | C=CCO[C@@H]1O[C@H](CO)[C@H](OC)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H28O10/c1-4-5-23-16-14(12(21)13(22-3)8(6-17)25-16)26-15-11(20)10(19)9(18)7(2)24-15/h4,7-21H,1,5-6H2,2-3H3/t7-,8+,9+,10+,11-,12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | FVSRKXSJIOCPQQ-DVMALCLKSA-N |
| XLogP | -2.51 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|