C13H22O6 — CID 11821811
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(prop-2-enoxy)oxan-4-ol (PubChem CID 11821811) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(prop-2-enoxy)oxan-4-ol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(prop-2-enoxy)oxan-4-ol |
|---|---|
| PubChem CID | 11821811 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(prop-2-enoxy)oxan-4-ol |
| SMILES | C=CCO[C@H]1[C@@H](OC)O[C@H](CO)[C@@H](OCC=C)[C@@H]1O |
| InChI | InChI=1S/C13H22O6/c1-4-6-17-11-9(8-14)19-13(16-3)12(10(11)15)18-7-5-2/h4-5,9-15H,1-2,6-8H2,3H3/t9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | TXLAAFFSBQGTSO-MLGHIDQZSA-N |
| XLogP | -0.15 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|