C22H36O11 — CID 102401700
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 102401700) has the molecular formula C22H36O11 and a molecular weight of 476.52 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102401700 |
| Molecular Formula | C22H36O11 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(prop-2-enoxy)oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | C=CCO[C@@H]1[C@@H](OCC=C)[C@@H](OC)O[C@H](CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1OCC=C |
| InChI | InChI=1S/C22H36O11/c1-5-8-28-18-14(12-31-21-17(26)16(25)15(24)13(11-23)32-21)33-22(27-4)20(30-10-7-3)19(18)29-9-6-2/h5-7,13-26H,1-3,8-12H2,4H3/t13-,14-,15-,16+,17-,18-,19+,20-,21+,22+/m1/s1 |
| InChIKey | KAAUVGUJBJRXLT-RVPSXVCVSA-N |
| XLogP | -1.11 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|