C15H26O11 — CID 101264111
(2R,3R,4S,5R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 101264111) has the molecular formula C15H26O11 and a molecular weight of 382.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101264111 |
| Molecular Formula | C15H26O11 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,5R,6S)-3,4,5-trihydroxy-6-prop-2-enoxyoxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | C=CCO[C@H]1O[C@H](COC2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H26O11/c1-2-3-23-14-12(21)11(20)9(18)7(26-14)5-24-15-13(22)10(19)8(17)6(4-16)25-15/h2,6-22H,1,3-5H2/t6-,7-,8+,9+,10+,11+,12-,13-,14+,15?/m1/s1 |
| InChIKey | JHGZCTAHNQKZKQ-RIXBVFOUSA-N |
| XLogP | -4.19 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|