C15H26O9 — CID 56683097
(2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methoxy]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 56683097) has the molecular formula C15H26O9 and a molecular weight of 350.36 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methoxy]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 56683097 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2S,3S,4S,5R)-2-[[(2R,3S,4S,5S)-3,4-dihydroxy-5-pent-4-enoxyoxolan-2-yl]methoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C=CCCCO[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H26O9/c1-2-3-4-5-21-14-13(20)11(18)9(24-14)7-22-15-12(19)10(17)8(6-16)23-15/h2,8-20H,1,3-7H2/t8-,9-,10-,11-,12+,13+,14+,15+/m1/s1 |
| InChIKey | WEBOGJPSZGHJKS-QTRYOLNXSA-N |
| XLogP | -2.13 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|