C20H38O9 — CID 545993
2-[(5-decoxy-3,4-dihydroxyoxolan-2-yl)methoxy]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 545993) has the molecular formula C20H38O9 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-[(5-decoxy-3,4-dihydroxyoxolan-2-yl)methoxy]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | 2-[(5-decoxy-3,4-dihydroxyoxolan-2-yl)methoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 545993 |
| Molecular Formula | C20H38O9 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[(5-decoxy-3,4-dihydroxyoxolan-2-yl)methoxy]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCCCOC1OC(COC2OC(CO)C(O)C2O)C(O)C1O |
| InChI | InChI=1S/C20H38O9/c1-2-3-4-5-6-7-8-9-10-26-19-18(25)16(23)14(29-19)12-27-20-17(24)15(22)13(11-21)28-20/h13-25H,2-12H2,1H3 |
| InChIKey | SWZNETICUQMOQU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|