C14H26O12 — CID 25194280
(2R,3S,4R,5S,6R,7S)-2-(hydroxymethyl)-7-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxepane-3,4,5,6-tetrol (PubChem CID 25194280) has the molecular formula C14H26O12 and a molecular weight of 386.35 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R,7S)-2-(hydroxymethyl)-7-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxepane-3,4,5,6-tetrol.
| Compound Name | (2R,3S,4R,5S,6R,7S)-2-(hydroxymethyl)-7-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 25194280 |
| Molecular Formula | C14H26O12 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R,3S,4R,5S,6R,7S)-2-(hydroxymethyl)-7-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methoxy]oxepane-3,4,5,6-tetrol |
| SMILES | CO[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O12/c1-23-13-11(21)9(19)7(17)5(26-13)3-24-14-12(22)10(20)8(18)6(16)4(2-15)25-14/h4-22H,2-3H2,1H3/t4-,5-,6-,7-,8+,9+,10+,11-,12-,13+,14+/m1/s1 |
| InChIKey | PHHFKLHTBVKKBJ-VAHWXTJUSA-N |
| XLogP | -5.38 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |