C12H20O7S — CID 129390139
[(2R,3S,4R)-4-hydroxy-2-[[(2R)-oxan-2-yl]oxymethyl]-3,4-dihydro-2H-pyran-3-yl] methanesulfonate (PubChem CID 129390139) has the molecular formula C12H20O7S and a molecular weight of 308.35 g/mol. Its IUPAC name is [(2R,3S,4R)-4-hydroxy-2-[[(2R)-oxan-2-yl]oxymethyl]-3,4-dihydro-2H-pyran-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,4R)-4-hydroxy-2-[[(2R)-oxan-2-yl]oxymethyl]-3,4-dihydro-2H-pyran-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 129390139 |
| Molecular Formula | C12H20O7S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [(2R,3S,4R)-4-hydroxy-2-[[(2R)-oxan-2-yl]oxymethyl]-3,4-dihydro-2H-pyran-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1[C@H](O)C=CO[C@@H]1CO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C12H20O7S/c1-20(14,15)19-12-9(13)5-7-16-10(12)8-18-11-4-2-3-6-17-11/h5,7,9-13H,2-4,6,8H2,1H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | ZEJGRKQBQSYMEI-KKOKHZNYSA-N |
| XLogP | 0.15 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|