C21H38N2O7S — CID 57025337
tert-butyl (2S,4R)-4-methylsulfonyloxy-2-[1-[2-(oxan-2-yloxy)ethyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate (PubChem CID 57025337) has the molecular formula C21H38N2O7S and a molecular weight of 462.61 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-methylsulfonyloxy-2-[1-[2-(oxan-2-yloxy)ethyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-methylsulfonyloxy-2-[1-[2-(oxan-2-yloxy)ethyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57025337 |
| Molecular Formula | C21H38N2O7S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | tert-butyl (2S,4R)-4-methylsulfonyloxy-2-[1-[2-(oxan-2-yloxy)ethyl]pyrrolidin-3-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1C1CCN(CCOC2CCCCO2)C1 |
| InChI | InChI=1S/C21H38N2O7S/c1-21(2,3)29-20(24)23-15-17(30-31(4,25)26)13-18(23)16-8-9-22(14-16)10-12-28-19-7-5-6-11-27-19/h16-19H,5-15H2,1-4H3/t16?,17-,18+,19?/m1/s1 |
| InChIKey | VKIRFHYSLJLYJK-IAFLDTSXSA-N |
| XLogP | 2.21 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|