C19H33NO8S — CID 89385811
tert-butyl (2S,4R)-2-[(4-methoxycarbonylcyclohexyl)oxymethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 89385811) has the molecular formula C19H33NO8S and a molecular weight of 435.54 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[(4-methoxycarbonylcyclohexyl)oxymethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[(4-methoxycarbonylcyclohexyl)oxymethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89385811 |
| Molecular Formula | C19H33NO8S |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | tert-butyl (2S,4R)-2-[(4-methoxycarbonylcyclohexyl)oxymethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | COC(=O)C1CCC(OC[C@@H]2C[C@@H](OS(C)(=O)=O)CN2C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H33NO8S/c1-19(2,3)27-18(22)20-11-16(28-29(5,23)24)10-14(20)12-26-15-8-6-13(7-9-15)17(21)25-4/h13-16H,6-12H2,1-5H3/t13?,14-,15?,16+/m0/s1 |
| InChIKey | OQZBPPHKENRNIY-BHDPWAOGSA-N |
| XLogP | 2.09 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|