C22H37NO5 — CID 69333230
tert-butyl 3-[(4-methoxycarbonylcyclohexyl)oxymethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 69333230) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl 3-[(4-methoxycarbonylcyclohexyl)oxymethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-methoxycarbonylcyclohexyl)oxymethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 69333230 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | tert-butyl 3-[(4-methoxycarbonylcyclohexyl)oxymethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | COC(=O)C1CCC(OCC2CN(C(=O)OC(C)(C)C)C3CCCCC23)CC1 |
| InChI | InChI=1S/C22H37NO5/c1-22(2,3)28-21(25)23-13-16(18-7-5-6-8-19(18)23)14-27-17-11-9-15(10-12-17)20(24)26-4/h15-19H,5-14H2,1-4H3 |
| InChIKey | CLWMQXFKBXHPLM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |