C17H30N2O3S — CID 18657907
tert-butyl (2S,4S)-4-acetylsulfanyl-2-(1-ethylpyrrolidin-3-yl)pyrrolidine-1-carboxylate (PubChem CID 18657907) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-acetylsulfanyl-2-(1-ethylpyrrolidin-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-acetylsulfanyl-2-(1-ethylpyrrolidin-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18657907 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | tert-butyl (2S,4S)-4-acetylsulfanyl-2-(1-ethylpyrrolidin-3-yl)pyrrolidine-1-carboxylate |
| SMILES | CCN1CCC([C@@H]2C[C@H](SC(C)=O)CN2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H30N2O3S/c1-6-18-8-7-13(10-18)15-9-14(23-12(2)20)11-19(15)16(21)22-17(3,4)5/h13-15H,6-11H2,1-5H3/t13?,14-,15-/m0/s1 |
| InChIKey | QOWYLZVCXQDVGR-FGRDXJNISA-N |
| XLogP | 2.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|