C17H28N2O4S — CID 91546993
tert-butyl 4-acetylsulfanyl-2-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 91546993) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is tert-butyl 4-acetylsulfanyl-2-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-acetylsulfanyl-2-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91546993 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | tert-butyl 4-acetylsulfanyl-2-(piperidine-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(=O)SC1CC(C(=O)N2CCCCC2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H28N2O4S/c1-12(20)24-13-10-14(15(21)18-8-6-5-7-9-18)19(11-13)16(22)23-17(2,3)4/h13-14H,5-11H2,1-4H3 |
| InChIKey | SCXPZNURMWFOCF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|