C16H28N2O3 — CID 10469863
tert-butyl (2S)-2-(azepane-1-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 10469863) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl (2S)-2-(azepane-1-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(azepane-1-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10469863 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | tert-butyl (2S)-2-(azepane-1-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H28N2O3/c1-16(2,3)21-15(20)18-12-8-9-13(18)14(19)17-10-6-4-5-7-11-17/h13H,4-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | PPZCZDDITRWUES-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |