C17H31N3O3 — CID 143899487
tert-butyl (2R)-2-[4-(dimethylamino)piperidine-1-carbonyl]pyrrolidine-1-carboxylate (PubChem CID 143899487) has the molecular formula C17H31N3O3 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[4-(dimethylamino)piperidine-1-carbonyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[4-(dimethylamino)piperidine-1-carbonyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143899487 |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl (2R)-2-[4-(dimethylamino)piperidine-1-carbonyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C1CCN(C(=O)[C@H]2CCCN2C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H31N3O3/c1-17(2,3)23-16(22)20-10-6-7-14(20)15(21)19-11-8-13(9-12-19)18(4)5/h13-14H,6-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | HTNMUBCRTGKKJD-CQSZACIVSA-N |
| XLogP | 1.94 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |