C16H28N2O4 — CID 77134389
ditert-butyl 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate (PubChem CID 77134389) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is ditert-butyl 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate.
| Compound Name | ditert-butyl 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 77134389 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | ditert-butyl 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CCN(C(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C16H28N2O4/c1-15(2,3)21-13(19)17-9-11-7-8-18(12(11)10-17)14(20)22-16(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | NUFHKZGSNPPTQP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |