C23H35N3O5 — CID 66883343
1-O-tert-butyl 5-O-[(1R,3S)-5-carbamoyl-2-adamantyl] 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate (PubChem CID 66883343) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[(1R,3S)-5-carbamoyl-2-adamantyl] 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-[(1R,3S)-5-carbamoyl-2-adamantyl] 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 66883343 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1-O-tert-butyl 5-O-[(1R,3S)-5-carbamoyl-2-adamantyl] 2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(C(=O)OC3[C@@H]4CC5C[C@H]3CC(C(N)=O)(C5)C4)CC21 |
| InChI | InChI=1S/C23H35N3O5/c1-22(2,3)31-21(29)26-5-4-14-11-25(12-17(14)26)20(28)30-18-15-6-13-7-16(18)10-23(8-13,9-15)19(24)27/h13-18H,4-12H2,1-3H3,(H2,24,27)/t13?,14?,15-,16+,17?,18?,23? |
| InChIKey | VAPCWIOHYNIGLM-JFSKXJFISA-N |
| XLogP | 2.74 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |