C17H30O5S — CID 54338804
[(2R,3S)-6,6-dimethyl-2-[2-(oxan-2-yloxy)ethyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate (PubChem CID 54338804) has the molecular formula C17H30O5S and a molecular weight of 346.49 g/mol. Its IUPAC name is [(2R,3S)-6,6-dimethyl-2-[2-(oxan-2-yloxy)ethyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate.
| Compound Name | [(2R,3S)-6,6-dimethyl-2-[2-(oxan-2-yloxy)ethyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 54338804 |
| Molecular Formula | C17H30O5S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(2R,3S)-6,6-dimethyl-2-[2-(oxan-2-yloxy)ethyl]-3-bicyclo[3.1.1]heptanyl] methanesulfonate |
| SMILES | CC1(C)C2CC1[C@@H](CCOC1CCCCO1)[C@@H](OS(C)(=O)=O)C2 |
| InChI | InChI=1S/C17H30O5S/c1-17(2)12-10-14(17)13(15(11-12)22-23(3,18)19)7-9-21-16-6-4-5-8-20-16/h12-16H,4-11H2,1-3H3/t12?,13-,14?,15+,16?/m1/s1 |
| InChIKey | TXLLNHUUTWFMIQ-ZCCLKROQSA-N |
| XLogP | 2.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|