C32H46N2O10S — CID 24796945
[4-[4-[5-methyl-3-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butyl]phenyl]methyl methanesulfonate (PubChem CID 24796945) has the molecular formula C32H46N2O10S and a molecular weight of 650.79 g/mol. Its IUPAC name is [4-[4-[5-methyl-3-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butyl]phenyl]methyl methanesulfonate.
| Compound Name | [4-[4-[5-methyl-3-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butyl]phenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 24796945 |
| Molecular Formula | C32H46N2O10S |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | [4-[4-[5-methyl-3-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]butyl]phenyl]methyl methanesulfonate |
| SMILES | Cc1cn([C@H]2C[C@H](OC3CCCCO3)[C@@H](COC3CCCCO3)O2)c(=O)n(CCCCc2ccc(COS(C)(=O)=O)cc2)c1=O |
| InChI | InChI=1S/C32H46N2O10S/c1-23-20-34(28-19-26(44-30-11-5-8-18-40-30)27(43-28)22-41-29-10-4-7-17-39-29)32(36)33(31(23)35)16-6-3-9-24-12-14-25(15-13-24)21-42-45(2,37)38/h12-15,20,26-30H,3-11,16-19,21-22H2,1-2H3/t26-,27+,28+,29?,30?/m0/s1 |
| InChIKey | AOWFPJLZVUZZAW-NYJLXZOVSA-N |
| XLogP | 3.56 |
| TPSA | 133.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|