C32H44N2O8 — CID 143636481
1-[(2R,4R,5R)-4-hydroxy-4-(oxan-2-yl)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-5-methyl-3-(6-oxo-6-phenylhexyl)pyrimidine-2,4-dione (PubChem CID 143636481) has the molecular formula C32H44N2O8 and a molecular weight of 584.71 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-hydroxy-4-(oxan-2-yl)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-5-methyl-3-(6-oxo-6-phenylhexyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-4-hydroxy-4-(oxan-2-yl)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-5-methyl-3-(6-oxo-6-phenylhexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143636481 |
| Molecular Formula | C32H44N2O8 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 1-[(2R,4R,5R)-4-hydroxy-4-(oxan-2-yl)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-5-methyl-3-(6-oxo-6-phenylhexyl)pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@](O)(C3CCCCO3)[C@@H](COC3CCCCO3)O2)c(=O)n(CCCCCC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C32H44N2O8/c1-23-21-34(31(37)33(30(23)36)17-9-3-6-14-25(35)24-12-4-2-5-13-24)28-20-32(38,26-15-7-10-18-39-26)27(42-28)22-41-29-16-8-11-19-40-29/h2,4-5,12-13,21,26-29,38H,3,6-11,14-20,22H2,1H3/t26?,27-,28-,29?,32-/m1/s1 |
| InChIKey | HEOMUSBYQOPWRB-DJTCJYNNSA-N |
| XLogP | 3.89 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|