C22H30N2O8 — CID 121487461
(E)-3-[1-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enal (PubChem CID 121487461) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is (E)-3-[1-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enal.
| Compound Name | (E)-3-[1-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 121487461 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (E)-3-[1-[(2R,4S,5R)-4-(oxan-2-yloxy)-5-(oxan-2-yloxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-enal |
| SMILES | O=C/C=C/c1cn([C@H]2C[C@H](OC3CCCCO3)[C@@H](COC3CCCCO3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H30N2O8/c25-9-5-6-15-13-24(22(27)23-21(15)26)18-12-16(32-20-8-2-4-11-29-20)17(31-18)14-30-19-7-1-3-10-28-19/h5-6,9,13,16-20H,1-4,7-8,10-12,14H2,(H,23,26,27)/b6-5+/t16-,17+,18+,19?,20?/m0/s1 |
| InChIKey | PTIBMSYAUMTCKC-AOIZJTBBSA-N |
| XLogP | 1.49 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|